C24H22N4O5 — CID 46283236
N-[(2,4-dimethoxyphenyl)methyl]-4-[(2,3-dioxo-1H-pyrido[2,3-b]pyrazin-4-yl)methyl]benzamide (PubChem CID 46283236) has the molecular formula C24H22N4O5 and a molecular weight of 446.46 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-4-[(2,3-dioxo-1H-pyrido[2,3-b]pyrazin-4-yl)methyl]benzamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-4-[(2,3-dioxo-1H-pyrido[2,3-b]pyrazin-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 46283236 |
| Molecular Formula | C24H22N4O5 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-4-[(2,3-dioxo-1H-pyrido[2,3-b]pyrazin-4-yl)methyl]benzamide |
| SMILES | COc1ccc(CNC(=O)c2ccc(Cn3c(=O)c(=O)[nH]c4cccnc43)cc2)c(OC)c1 |
| InChI | InChI=1S/C24H22N4O5/c1-32-18-10-9-17(20(12-18)33-2)13-26-22(29)16-7-5-15(6-8-16)14-28-21-19(4-3-11-25-21)27-23(30)24(28)31/h3-12H,13-14H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | QJOJGZPXVWAXAN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|