C15H13ClN4O4 — CID 154663192
4-chloro-8-[(2,4-dimethoxyphenyl)methyl]-5H-pteridine-6,7-dione (PubChem CID 154663192) has the molecular formula C15H13ClN4O4 and a molecular weight of 348.75 g/mol. Its IUPAC name is 4-chloro-8-[(2,4-dimethoxyphenyl)methyl]-5H-pteridine-6,7-dione.
| Compound Name | 4-chloro-8-[(2,4-dimethoxyphenyl)methyl]-5H-pteridine-6,7-dione |
|---|---|
| PubChem CID | 154663192 |
| Molecular Formula | C15H13ClN4O4 |
| Molecular Weight | 348.75 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 4-chloro-8-[(2,4-dimethoxyphenyl)methyl]-5H-pteridine-6,7-dione |
| SMILES | COc1ccc(Cn2c(=O)c(=O)[nH]c3c(Cl)ncnc32)c(OC)c1 |
| InChI | InChI=1S/C15H13ClN4O4/c1-23-9-4-3-8(10(5-9)24-2)6-20-13-11(12(16)17-7-18-13)19-14(21)15(20)22/h3-5,7H,6H2,1-2H3,(H,19,21) |
| InChIKey | AJHALYFQKODCLA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.75 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|