C14H13Cl2NO4 — CID 162343397
3,4-dichloro-1-[(2,4-dimethoxyphenyl)methoxy]pyridin-2-one (PubChem CID 162343397) has the molecular formula C14H13Cl2NO4 and a molecular weight of 330.17 g/mol. Its IUPAC name is 3,4-dichloro-1-[(2,4-dimethoxyphenyl)methoxy]pyridin-2-one.
| Compound Name | 3,4-dichloro-1-[(2,4-dimethoxyphenyl)methoxy]pyridin-2-one |
|---|---|
| PubChem CID | 162343397 |
| Molecular Formula | C14H13Cl2NO4 |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 3,4-dichloro-1-[(2,4-dimethoxyphenyl)methoxy]pyridin-2-one |
| SMILES | COc1ccc(COn2ccc(Cl)c(Cl)c2=O)c(OC)c1 |
| InChI | InChI=1S/C14H13Cl2NO4/c1-19-10-4-3-9(12(7-10)20-2)8-21-17-6-5-11(15)13(16)14(17)18/h3-7H,8H2,1-2H3 |
| InChIKey | MEKNPTNYCBVWJF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |