C17H15ClN2O3 — CID 171795802
7-chloro-1-[(2,4-dimethoxyphenyl)methyl]-1,8-naphthyridin-4-one (PubChem CID 171795802) has the molecular formula C17H15ClN2O3 and a molecular weight of 330.77 g/mol. Its IUPAC name is 7-chloro-1-[(2,4-dimethoxyphenyl)methyl]-1,8-naphthyridin-4-one.
| Compound Name | 7-chloro-1-[(2,4-dimethoxyphenyl)methyl]-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 171795802 |
| Molecular Formula | C17H15ClN2O3 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 7-chloro-1-[(2,4-dimethoxyphenyl)methyl]-1,8-naphthyridin-4-one |
| SMILES | COc1ccc(Cn2ccc(=O)c3ccc(Cl)nc32)c(OC)c1 |
| InChI | InChI=1S/C17H15ClN2O3/c1-22-12-4-3-11(15(9-12)23-2)10-20-8-7-14(21)13-5-6-16(18)19-17(13)20/h3-9H,10H2,1-2H3 |
| InChIKey | OTBGRVDSILUISQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|