C16H15NO7 — CID 123329362
1-[(2,4-dimethoxyphenyl)methyl]-2-oxopyridine-3,4-dicarboxylic acid (PubChem CID 123329362) has the molecular formula C16H15NO7 and a molecular weight of 333.30 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-2-oxopyridine-3,4-dicarboxylic acid.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-2-oxopyridine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 123329362 |
| Molecular Formula | C16H15NO7 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-2-oxopyridine-3,4-dicarboxylic acid |
| SMILES | COc1ccc(Cn2ccc(C(=O)O)c(C(=O)O)c2=O)c(OC)c1 |
| InChI | InChI=1S/C16H15NO7/c1-23-10-4-3-9(12(7-10)24-2)8-17-6-5-11(15(19)20)13(14(17)18)16(21)22/h3-7H,8H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | VARGSHCXEHNYPM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |