C19H22BrNO5 — CID 174713299
ethyl 3-(bromomethyl)-1-[2-(2,4-dimethoxyphenyl)ethyl]-2-oxopyridine-4-carboxylate (PubChem CID 174713299) has the molecular formula C19H22BrNO5 and a molecular weight of 424.29 g/mol. Its IUPAC name is ethyl 3-(bromomethyl)-1-[2-(2,4-dimethoxyphenyl)ethyl]-2-oxopyridine-4-carboxylate.
| Compound Name | ethyl 3-(bromomethyl)-1-[2-(2,4-dimethoxyphenyl)ethyl]-2-oxopyridine-4-carboxylate |
|---|---|
| PubChem CID | 174713299 |
| Molecular Formula | C19H22BrNO5 |
| Molecular Weight | 424.29 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | ethyl 3-(bromomethyl)-1-[2-(2,4-dimethoxyphenyl)ethyl]-2-oxopyridine-4-carboxylate |
| SMILES | CCOC(=O)c1ccn(CCc2ccc(OC)cc2OC)c(=O)c1CBr |
| InChI | InChI=1S/C19H22BrNO5/c1-4-26-19(23)15-8-10-21(18(22)16(15)12-20)9-7-13-5-6-14(24-2)11-17(13)25-3/h5-6,8,10-11H,4,7,9,12H2,1-3H3 |
| InChIKey | UDNZPZQQTDVBTH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|