C19H26N2O4 — CID 12812987
ethyl 2-[2-(diethylamino)ethyl]-7-methoxy-1-oxoisoquinoline-4-carboxylate (PubChem CID 12812987) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is ethyl 2-[2-(diethylamino)ethyl]-7-methoxy-1-oxoisoquinoline-4-carboxylate.
| Compound Name | ethyl 2-[2-(diethylamino)ethyl]-7-methoxy-1-oxoisoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 12812987 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | ethyl 2-[2-(diethylamino)ethyl]-7-methoxy-1-oxoisoquinoline-4-carboxylate |
| SMILES | CCOC(=O)c1cn(CCN(CC)CC)c(=O)c2cc(OC)ccc12 |
| InChI | InChI=1S/C19H26N2O4/c1-5-20(6-2)10-11-21-13-17(19(23)25-7-3)15-9-8-14(24-4)12-16(15)18(21)22/h8-9,12-13H,5-7,10-11H2,1-4H3 |
| InChIKey | FTVGSEQBBZTXPY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |