C16H16BrNO5 — CID 141351917
3-(bromomethyl)-1-[(2,4-dimethoxyphenyl)methyl]-2-oxopyridine-4-carboxylic acid (PubChem CID 141351917) has the molecular formula C16H16BrNO5 and a molecular weight of 382.21 g/mol. Its IUPAC name is 3-(bromomethyl)-1-[(2,4-dimethoxyphenyl)methyl]-2-oxopyridine-4-carboxylic acid.
| Compound Name | 3-(bromomethyl)-1-[(2,4-dimethoxyphenyl)methyl]-2-oxopyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 141351917 |
| Molecular Formula | C16H16BrNO5 |
| Molecular Weight | 382.21 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | 3-(bromomethyl)-1-[(2,4-dimethoxyphenyl)methyl]-2-oxopyridine-4-carboxylic acid |
| SMILES | COc1ccc(Cn2ccc(C(=O)O)c(CBr)c2=O)c(OC)c1 |
| InChI | InChI=1S/C16H16BrNO5/c1-22-11-4-3-10(14(7-11)23-2)9-18-6-5-12(16(20)21)13(8-17)15(18)19/h3-7H,8-9H2,1-2H3,(H,20,21) |
| InChIKey | PCRZJCBINFVZFD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.21 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|