C16H20N2O5 — CID 91005120
3-[1-[(2,4-dimethoxyphenyl)methyl]-2-hydroxypyrrol-3-yl]-N-hydroxypropanamide (PubChem CID 91005120) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is 3-[1-[(2,4-dimethoxyphenyl)methyl]-2-hydroxypyrrol-3-yl]-N-hydroxypropanamide.
| Compound Name | 3-[1-[(2,4-dimethoxyphenyl)methyl]-2-hydroxypyrrol-3-yl]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 91005120 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 3-[1-[(2,4-dimethoxyphenyl)methyl]-2-hydroxypyrrol-3-yl]-N-hydroxypropanamide |
| SMILES | COc1ccc(Cn2ccc(CCC(=O)NO)c2O)c(OC)c1 |
| InChI | InChI=1S/C16H20N2O5/c1-22-13-5-3-12(14(9-13)23-2)10-18-8-7-11(16(18)20)4-6-15(19)17-21/h3,5,7-9,20-21H,4,6,10H2,1-2H3,(H,17,19) |
| InChIKey | XPYHACBRNIXZSO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|