C17H26N2O6S — CID 175559883
7-[5-[(2,4-dimethoxyphenyl)methyl]-1,3,4,2-dioxathiazolidin-2-yl]-N-hydroxyheptanamide (PubChem CID 175559883) has the molecular formula C17H26N2O6S and a molecular weight of 386.47 g/mol. Its IUPAC name is 7-[5-[(2,4-dimethoxyphenyl)methyl]-1,3,4,2-dioxathiazolidin-2-yl]-N-hydroxyheptanamide.
| Compound Name | 7-[5-[(2,4-dimethoxyphenyl)methyl]-1,3,4,2-dioxathiazolidin-2-yl]-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 175559883 |
| Molecular Formula | C17H26N2O6S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 7-[5-[(2,4-dimethoxyphenyl)methyl]-1,3,4,2-dioxathiazolidin-2-yl]-N-hydroxyheptanamide |
| SMILES | COc1ccc(CC2ON(CCCCCCC(=O)NO)OS2)c(OC)c1 |
| InChI | InChI=1S/C17H26N2O6S/c1-22-14-9-8-13(15(12-14)23-2)11-17-24-19(25-26-17)10-6-4-3-5-7-16(20)18-21/h8-9,12,17,21H,3-7,10-11H2,1-2H3,(H,18,20) |
| InChIKey | VTPPLBQGNRBTIE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|