C25H28BrN3O6 — CID 87531492
7-bromo-N-[(2,4-dimethoxyphenyl)methyl]-N-[6-(hydroxyamino)-6-oxohexyl]-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 87531492) has the molecular formula C25H28BrN3O6 and a molecular weight of 546.42 g/mol. Its IUPAC name is 7-bromo-N-[(2,4-dimethoxyphenyl)methyl]-N-[6-(hydroxyamino)-6-oxohexyl]-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | 7-bromo-N-[(2,4-dimethoxyphenyl)methyl]-N-[6-(hydroxyamino)-6-oxohexyl]-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 87531492 |
| Molecular Formula | C25H28BrN3O6 |
| Molecular Weight | 546.42 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | 7-bromo-N-[(2,4-dimethoxyphenyl)methyl]-N-[6-(hydroxyamino)-6-oxohexyl]-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | COc1ccc(CN(CCCCCC(=O)NO)C(=O)c2c[nH]c3cc(Br)ccc3c2=O)c(OC)c1 |
| InChI | InChI=1S/C25H28BrN3O6/c1-34-18-9-7-16(22(13-18)35-2)15-29(11-5-3-4-6-23(30)28-33)25(32)20-14-27-21-12-17(26)8-10-19(21)24(20)31/h7-10,12-14,33H,3-6,11,15H2,1-2H3,(H,27,31)(H,28,30) |
| InChIKey | OJLDVZPVWOGBLW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|