C25H43NO3 — CID 139819875
2,4-dimethoxy-N,N-dioctylbenzamide (PubChem CID 139819875) has the molecular formula C25H43NO3 and a molecular weight of 405.62 g/mol. Its IUPAC name is 2,4-dimethoxy-N,N-dioctylbenzamide.
| Compound Name | 2,4-dimethoxy-N,N-dioctylbenzamide |
|---|---|
| PubChem CID | 139819875 |
| Molecular Formula | C25H43NO3 |
| Molecular Weight | 405.62 g/mol |
| Exact Mass | 405.32 |
| IUPAC Name | 2,4-dimethoxy-N,N-dioctylbenzamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C(=O)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C25H43NO3/c1-5-7-9-11-13-15-19-26(20-16-14-12-10-8-6-2)25(27)23-18-17-22(28-3)21-24(23)29-4/h17-18,21H,5-16,19-20H2,1-4H3 |
| InChIKey | NZFNRXFUVMQDSE-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.62 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|