C18H27NO4 — CID 56803297
2,4-dimethoxy-N-(oxan-2-ylmethyl)-N-propylbenzamide (PubChem CID 56803297) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2,4-dimethoxy-N-(oxan-2-ylmethyl)-N-propylbenzamide.
| Compound Name | 2,4-dimethoxy-N-(oxan-2-ylmethyl)-N-propylbenzamide |
|---|---|
| PubChem CID | 56803297 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 2,4-dimethoxy-N-(oxan-2-ylmethyl)-N-propylbenzamide |
| SMILES | CCCN(CC1CCCCO1)C(=O)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C18H27NO4/c1-4-10-19(13-15-7-5-6-11-23-15)18(20)16-9-8-14(21-2)12-17(16)22-3/h8-9,12,15H,4-7,10-11,13H2,1-3H3 |
| InChIKey | KJFLZQPGSJTXOE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |