C18H28N2O4 — CID 91842038
N-(2,4-dimethoxyphenyl)-3-[methyl(oxan-2-ylmethyl)amino]propanamide (PubChem CID 91842038) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-3-[methyl(oxan-2-ylmethyl)amino]propanamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-3-[methyl(oxan-2-ylmethyl)amino]propanamide |
|---|---|
| PubChem CID | 91842038 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-3-[methyl(oxan-2-ylmethyl)amino]propanamide |
| SMILES | COc1ccc(NC(=O)CCN(C)CC2CCCCO2)c(OC)c1 |
| InChI | InChI=1S/C18H28N2O4/c1-20(13-15-6-4-5-11-24-15)10-9-18(21)19-16-8-7-14(22-2)12-17(16)23-3/h7-8,12,15H,4-6,9-11,13H2,1-3H3,(H,19,21) |
| InChIKey | KHRNUTCOGREZHO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |