C17H26N2O4 — CID 86825214
N-(2,4-dimethoxyphenyl)-2-[methyl(oxan-2-ylmethyl)amino]acetamide (PubChem CID 86825214) has the molecular formula C17H26N2O4 and a molecular weight of 322.40 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-[methyl(oxan-2-ylmethyl)amino]acetamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-[methyl(oxan-2-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 86825214 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-[methyl(oxan-2-ylmethyl)amino]acetamide |
| SMILES | COc1ccc(NC(=O)CN(C)CC2CCCCO2)c(OC)c1 |
| InChI | InChI=1S/C17H26N2O4/c1-19(11-14-6-4-5-9-23-14)12-17(20)18-15-8-7-13(21-2)10-16(15)22-3/h7-8,10,14H,4-6,9,11-12H2,1-3H3,(H,18,20) |
| InChIKey | GUZUDLJLUMJBIF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |