C19H29NO3 — CID 22716819
5-formyl-2-methoxy-N,N-dipentylbenzamide (PubChem CID 22716819) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is 5-formyl-2-methoxy-N,N-dipentylbenzamide.
| Compound Name | 5-formyl-2-methoxy-N,N-dipentylbenzamide |
|---|---|
| PubChem CID | 22716819 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 5-formyl-2-methoxy-N,N-dipentylbenzamide |
| SMILES | CCCCCN(CCCCC)C(=O)c1cc(C=O)ccc1OC |
| InChI | InChI=1S/C19H29NO3/c1-4-6-8-12-20(13-9-7-5-2)19(22)17-14-16(15-21)10-11-18(17)23-3/h10-11,14-15H,4-9,12-13H2,1-3H3 |
| InChIKey | XSOMVWJDTCGXDN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|