C15H24N2O4 — CID 63287508
N-(3-aminopropyl)-2,5-dimethoxy-N-(2-methoxyethyl)benzamide (PubChem CID 63287508) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is N-(3-aminopropyl)-2,5-dimethoxy-N-(2-methoxyethyl)benzamide.
| Compound Name | N-(3-aminopropyl)-2,5-dimethoxy-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 63287508 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | N-(3-aminopropyl)-2,5-dimethoxy-N-(2-methoxyethyl)benzamide |
| SMILES | COCCN(CCCN)C(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C15H24N2O4/c1-19-10-9-17(8-4-7-16)15(18)13-11-12(20-2)5-6-14(13)21-3/h5-6,11H,4,7-10,16H2,1-3H3 |
| InChIKey | UUDRUOOLBXHPRK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |