C21H25BrN2O5 — CID 71617100
N'-[(3-bromophenyl)methyl]-N'-(2,4-dimethoxyphenyl)-N-hydroxyhexanediamide (PubChem CID 71617100) has the molecular formula C21H25BrN2O5 and a molecular weight of 465.34 g/mol. Its IUPAC name is N'-[(3-bromophenyl)methyl]-N'-(2,4-dimethoxyphenyl)-N-hydroxyhexanediamide.
| Compound Name | N'-[(3-bromophenyl)methyl]-N'-(2,4-dimethoxyphenyl)-N-hydroxyhexanediamide |
|---|---|
| PubChem CID | 71617100 |
| Molecular Formula | C21H25BrN2O5 |
| Molecular Weight | 465.34 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | N'-[(3-bromophenyl)methyl]-N'-(2,4-dimethoxyphenyl)-N-hydroxyhexanediamide |
| SMILES | COc1ccc(N(Cc2cccc(Br)c2)C(=O)CCCCC(=O)NO)c(OC)c1 |
| InChI | InChI=1S/C21H25BrN2O5/c1-28-17-10-11-18(19(13-17)29-2)24(14-15-6-5-7-16(22)12-15)21(26)9-4-3-8-20(25)23-27/h5-7,10-13,27H,3-4,8-9,14H2,1-2H3,(H,23,25) |
| InChIKey | UZQOUJLVPNPTEQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|