C24H23BrN2O4 — CID 71616759
N'-[(3-bromophenyl)methyl]-N-(2-hydroxyphenyl)-N'-(2-methoxyphenyl)butanediamide (PubChem CID 71616759) has the molecular formula C24H23BrN2O4 and a molecular weight of 483.36 g/mol. Its IUPAC name is N'-[(3-bromophenyl)methyl]-N-(2-hydroxyphenyl)-N'-(2-methoxyphenyl)butanediamide.
| Compound Name | N'-[(3-bromophenyl)methyl]-N-(2-hydroxyphenyl)-N'-(2-methoxyphenyl)butanediamide |
|---|---|
| PubChem CID | 71616759 |
| Molecular Formula | C24H23BrN2O4 |
| Molecular Weight | 483.36 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | N'-[(3-bromophenyl)methyl]-N-(2-hydroxyphenyl)-N'-(2-methoxyphenyl)butanediamide |
| SMILES | COc1ccccc1N(Cc1cccc(Br)c1)C(=O)CCC(=O)Nc1ccccc1O |
| InChI | InChI=1S/C24H23BrN2O4/c1-31-22-12-5-3-10-20(22)27(16-17-7-6-8-18(25)15-17)24(30)14-13-23(29)26-19-9-2-4-11-21(19)28/h2-12,15,28H,13-14,16H2,1H3,(H,26,29) |
| InChIKey | HSBAZHBAJRWGDW-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.36 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|