C22H26BrNO3S — CID 71615936
S-[6-[N-[(3-bromophenyl)methyl]-2-methoxyanilino]-6-oxohexyl] ethanethioate (PubChem CID 71615936) has the molecular formula C22H26BrNO3S and a molecular weight of 464.43 g/mol. Its IUPAC name is S-[6-[N-[(3-bromophenyl)methyl]-2-methoxyanilino]-6-oxohexyl] ethanethioate.
| Compound Name | S-[6-[N-[(3-bromophenyl)methyl]-2-methoxyanilino]-6-oxohexyl] ethanethioate |
|---|---|
| PubChem CID | 71615936 |
| Molecular Formula | C22H26BrNO3S |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | S-[6-[N-[(3-bromophenyl)methyl]-2-methoxyanilino]-6-oxohexyl] ethanethioate |
| SMILES | COc1ccccc1N(Cc1cccc(Br)c1)C(=O)CCCCCSC(C)=O |
| InChI | InChI=1S/C22H26BrNO3S/c1-17(25)28-14-7-3-4-13-22(26)24(16-18-9-8-10-19(23)15-18)20-11-5-6-12-21(20)27-2/h5-6,8-12,15H,3-4,7,13-14,16H2,1-2H3 |
| InChIKey | HADYGXVYNFRIMW-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|