C27H29NO4 — CID 134537287
methyl 3-[4-[(2-methoxy-N-pentanoylanilino)methyl]phenyl]benzoate (PubChem CID 134537287) has the molecular formula C27H29NO4 and a molecular weight of 431.53 g/mol. Its IUPAC name is methyl 3-[4-[(2-methoxy-N-pentanoylanilino)methyl]phenyl]benzoate.
| Compound Name | methyl 3-[4-[(2-methoxy-N-pentanoylanilino)methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 134537287 |
| Molecular Formula | C27H29NO4 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | methyl 3-[4-[(2-methoxy-N-pentanoylanilino)methyl]phenyl]benzoate |
| SMILES | CCCCC(=O)N(Cc1ccc(-c2cccc(C(=O)OC)c2)cc1)c1ccccc1OC |
| InChI | InChI=1S/C27H29NO4/c1-4-5-13-26(29)28(24-11-6-7-12-25(24)31-2)19-20-14-16-21(17-15-20)22-9-8-10-23(18-22)27(30)32-3/h6-12,14-18H,4-5,13,19H2,1-3H3 |
| InChIKey | QNMISEBRPRFPCK-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |