C31H32N2O5 — CID 126696176
methyl 1-[5-hydroxypentanoyl-[[4-(4-methoxy-3-methylphenyl)phenyl]methyl]amino]isoquinoline-6-carboxylate (PubChem CID 126696176) has the molecular formula C31H32N2O5 and a molecular weight of 512.61 g/mol. Its IUPAC name is methyl 1-[5-hydroxypentanoyl-[[4-(4-methoxy-3-methylphenyl)phenyl]methyl]amino]isoquinoline-6-carboxylate.
| Compound Name | methyl 1-[5-hydroxypentanoyl-[[4-(4-methoxy-3-methylphenyl)phenyl]methyl]amino]isoquinoline-6-carboxylate |
|---|---|
| PubChem CID | 126696176 |
| Molecular Formula | C31H32N2O5 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | methyl 1-[5-hydroxypentanoyl-[[4-(4-methoxy-3-methylphenyl)phenyl]methyl]amino]isoquinoline-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(N(Cc3ccc(-c4ccc(OC)c(C)c4)cc3)C(=O)CCCCO)nccc2c1 |
| InChI | InChI=1S/C31H32N2O5/c1-21-18-24(12-14-28(21)37-2)23-9-7-22(8-10-23)20-33(29(35)6-4-5-17-34)30-27-13-11-26(31(36)38-3)19-25(27)15-16-32-30/h7-16,18-19,34H,4-6,17,20H2,1-3H3 |
| InChIKey | GLVRMMFLJAAHRJ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|