C29H33N3O5 — CID 155512881
N-hydroxy-N'-(2-methoxyphenyl)-N'-[[3-[(2-phenylacetyl)amino]phenyl]methyl]heptanediamide (PubChem CID 155512881) has the molecular formula C29H33N3O5 and a molecular weight of 503.60 g/mol. Its IUPAC name is N-hydroxy-N'-(2-methoxyphenyl)-N'-[[3-[(2-phenylacetyl)amino]phenyl]methyl]heptanediamide.
| Compound Name | N-hydroxy-N'-(2-methoxyphenyl)-N'-[[3-[(2-phenylacetyl)amino]phenyl]methyl]heptanediamide |
|---|---|
| PubChem CID | 155512881 |
| Molecular Formula | C29H33N3O5 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | N-hydroxy-N'-(2-methoxyphenyl)-N'-[[3-[(2-phenylacetyl)amino]phenyl]methyl]heptanediamide |
| SMILES | COc1ccccc1N(Cc1cccc(NC(=O)Cc2ccccc2)c1)C(=O)CCCCCC(=O)NO |
| InChI | InChI=1S/C29H33N3O5/c1-37-26-16-9-8-15-25(26)32(29(35)18-7-3-6-17-27(33)31-36)21-23-13-10-14-24(19-23)30-28(34)20-22-11-4-2-5-12-22/h2,4-5,8-16,19,36H,3,6-7,17-18,20-21H2,1H3,(H,30,34)(H,31,33) |
| InChIKey | OCHZCXDIEKBKHV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|