C24H24N2O5 — CID 17235540
3,4,5-trimethoxy-N-[3-[(2-phenylacetyl)amino]phenyl]benzamide (PubChem CID 17235540) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[3-[(2-phenylacetyl)amino]phenyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[3-[(2-phenylacetyl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 17235540 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 3,4,5-trimethoxy-N-[3-[(2-phenylacetyl)amino]phenyl]benzamide |
| SMILES | COc1cc(C(=O)Nc2cccc(NC(=O)Cc3ccccc3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H24N2O5/c1-29-20-13-17(14-21(30-2)23(20)31-3)24(28)26-19-11-7-10-18(15-19)25-22(27)12-16-8-5-4-6-9-16/h4-11,13-15H,12H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | IOCDXEDAJSHXGF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |