C21H25N3O7 — CID 30831168
3,4,5-trimethoxy-N-[2-[3-[(2-methoxyacetyl)amino]anilino]-2-oxoethyl]benzamide (PubChem CID 30831168) has the molecular formula C21H25N3O7 and a molecular weight of 431.45 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[2-[3-[(2-methoxyacetyl)amino]anilino]-2-oxoethyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[2-[3-[(2-methoxyacetyl)amino]anilino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 30831168 |
| Molecular Formula | C21H25N3O7 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 3,4,5-trimethoxy-N-[2-[3-[(2-methoxyacetyl)amino]anilino]-2-oxoethyl]benzamide |
| SMILES | COCC(=O)Nc1cccc(NC(=O)CNC(=O)c2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C21H25N3O7/c1-28-12-19(26)24-15-7-5-6-14(10-15)23-18(25)11-22-21(27)13-8-16(29-2)20(31-4)17(9-13)30-3/h5-10H,11-12H2,1-4H3,(H,22,27)(H,23,25)(H,24,26) |
| InChIKey | JKWPVKATTKCVPK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |