C19H22N2O5S — CID 17475270
3,4,5-trimethoxy-N-[2-(3-methylsulfanylanilino)-2-oxoethyl]benzamide (PubChem CID 17475270) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[2-(3-methylsulfanylanilino)-2-oxoethyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[2-(3-methylsulfanylanilino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 17475270 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 3,4,5-trimethoxy-N-[2-(3-methylsulfanylanilino)-2-oxoethyl]benzamide |
| SMILES | COc1cc(C(=O)NCC(=O)Nc2cccc(SC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C19H22N2O5S/c1-24-15-8-12(9-16(25-2)18(15)26-3)19(23)20-11-17(22)21-13-6-5-7-14(10-13)27-4/h5-10H,11H2,1-4H3,(H,20,23)(H,21,22) |
| InChIKey | YFHPCRBDKCYBKK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |