C21H26N2O5 — CID 112996998
N-[2-(2-ethyl-6-methylanilino)-2-oxoethyl]-3,4,5-trimethoxybenzamide (PubChem CID 112996998) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is N-[2-(2-ethyl-6-methylanilino)-2-oxoethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-(2-ethyl-6-methylanilino)-2-oxoethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 112996998 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-[2-(2-ethyl-6-methylanilino)-2-oxoethyl]-3,4,5-trimethoxybenzamide |
| SMILES | CCc1cccc(C)c1NC(=O)CNC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C21H26N2O5/c1-6-14-9-7-8-13(2)19(14)23-18(24)12-22-21(25)15-10-16(26-3)20(28-5)17(11-15)27-4/h7-11H,6,12H2,1-5H3,(H,22,25)(H,23,24) |
| InChIKey | NWXVVYHKIWWQGA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |