C20H23N3O6 — CID 27259117
N-[2-(3-acetamidoanilino)-2-oxoethyl]-3,4,5-trimethoxybenzamide (PubChem CID 27259117) has the molecular formula C20H23N3O6 and a molecular weight of 401.42 g/mol. Its IUPAC name is N-[2-(3-acetamidoanilino)-2-oxoethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-(3-acetamidoanilino)-2-oxoethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 27259117 |
| Molecular Formula | C20H23N3O6 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | N-[2-(3-acetamidoanilino)-2-oxoethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(=O)Nc2cccc(NC(C)=O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C20H23N3O6/c1-12(24)22-14-6-5-7-15(10-14)23-18(25)11-21-20(26)13-8-16(27-2)19(29-4)17(9-13)28-3/h5-10H,11H2,1-4H3,(H,21,26)(H,22,24)(H,23,25) |
| InChIKey | TUUBEJBLBWHEJR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |