C24H31N3O5 — CID 38842437
3,4,5-trimethoxy-N-[2-oxo-2-[3-(piperidin-1-ylmethyl)anilino]ethyl]benzamide (PubChem CID 38842437) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[2-oxo-2-[3-(piperidin-1-ylmethyl)anilino]ethyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[2-oxo-2-[3-(piperidin-1-ylmethyl)anilino]ethyl]benzamide |
|---|---|
| PubChem CID | 38842437 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 3,4,5-trimethoxy-N-[2-oxo-2-[3-(piperidin-1-ylmethyl)anilino]ethyl]benzamide |
| SMILES | COc1cc(C(=O)NCC(=O)Nc2cccc(CN3CCCCC3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H31N3O5/c1-30-20-13-18(14-21(31-2)23(20)32-3)24(29)25-15-22(28)26-19-9-7-8-17(12-19)16-27-10-5-4-6-11-27/h7-9,12-14H,4-6,10-11,15-16H2,1-3H3,(H,25,29)(H,26,28) |
| InChIKey | NRLGWIVJXYCJQU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |