C21H25N3O6 — CID 30379109
N-[2-[3-(dimethylcarbamoyl)anilino]-2-oxoethyl]-3,4,5-trimethoxybenzamide (PubChem CID 30379109) has the molecular formula C21H25N3O6 and a molecular weight of 415.45 g/mol. Its IUPAC name is N-[2-[3-(dimethylcarbamoyl)anilino]-2-oxoethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-[3-(dimethylcarbamoyl)anilino]-2-oxoethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 30379109 |
| Molecular Formula | C21H25N3O6 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | N-[2-[3-(dimethylcarbamoyl)anilino]-2-oxoethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(=O)Nc2cccc(C(=O)N(C)C)c2)cc(OC)c1OC |
| InChI | InChI=1S/C21H25N3O6/c1-24(2)21(27)13-7-6-8-15(9-13)23-18(25)12-22-20(26)14-10-16(28-3)19(30-5)17(11-14)29-4/h6-11H,12H2,1-5H3,(H,22,26)(H,23,25) |
| InChIKey | XZUKSFMXYQRIOQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |