C17H15BrN2O3 — CID 162772120
8-bromo-6-[(2,4-dimethoxyphenyl)methyl]-1,6-naphthyridin-5-one (PubChem CID 162772120) has the molecular formula C17H15BrN2O3 and a molecular weight of 375.22 g/mol. Its IUPAC name is 8-bromo-6-[(2,4-dimethoxyphenyl)methyl]-1,6-naphthyridin-5-one.
| Compound Name | 8-bromo-6-[(2,4-dimethoxyphenyl)methyl]-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 162772120 |
| Molecular Formula | C17H15BrN2O3 |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 8-bromo-6-[(2,4-dimethoxyphenyl)methyl]-1,6-naphthyridin-5-one |
| SMILES | COc1ccc(Cn2cc(Br)c3ncccc3c2=O)c(OC)c1 |
| InChI | InChI=1S/C17H15BrN2O3/c1-22-12-6-5-11(15(8-12)23-2)9-20-10-14(18)16-13(17(20)21)4-3-7-19-16/h3-8,10H,9H2,1-2H3 |
| InChIKey | LOFCKSBCSQVXDP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |