C15H13N3O2 — CID 10825717
3-[(2-methoxyphenyl)methyl]pyrido[2,3-d]pyrimidin-4-one (PubChem CID 10825717) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 3-[(2-methoxyphenyl)methyl]pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(2-methoxyphenyl)methyl]pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 10825717 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 3-[(2-methoxyphenyl)methyl]pyrido[2,3-d]pyrimidin-4-one |
| SMILES | COc1ccccc1Cn1cnc2ncccc2c1=O |
| InChI | InChI=1S/C15H13N3O2/c1-20-13-7-3-2-5-11(13)9-18-10-17-14-12(15(18)19)6-4-8-16-14/h2-8,10H,9H2,1H3 |
| InChIKey | IXCXMBCZCFEYJB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |