C14H12N2O2S — CID 33278584
3-[(2-methoxyphenyl)methyl]thieno[3,2-d]pyrimidin-4-one (PubChem CID 33278584) has the molecular formula C14H12N2O2S and a molecular weight of 272.33 g/mol. Its IUPAC name is 3-[(2-methoxyphenyl)methyl]thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-[(2-methoxyphenyl)methyl]thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 33278584 |
| Molecular Formula | C14H12N2O2S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 3-[(2-methoxyphenyl)methyl]thieno[3,2-d]pyrimidin-4-one |
| SMILES | COc1ccccc1Cn1cnc2ccsc2c1=O |
| InChI | InChI=1S/C14H12N2O2S/c1-18-12-5-3-2-4-10(12)8-16-9-15-11-6-7-19-13(11)14(16)17/h2-7,9H,8H2,1H3 |
| InChIKey | WGUCSEDDFZELNQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |