C19H19BrN2O3 — CID 131987068
5-bromo-7-[[(2,4-dimethoxyphenyl)methylamino]methyl]quinolin-8-ol (PubChem CID 131987068) has the molecular formula C19H19BrN2O3 and a molecular weight of 403.28 g/mol. Its IUPAC name is 5-bromo-7-[[(2,4-dimethoxyphenyl)methylamino]methyl]quinolin-8-ol.
| Compound Name | 5-bromo-7-[[(2,4-dimethoxyphenyl)methylamino]methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 131987068 |
| Molecular Formula | C19H19BrN2O3 |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 5-bromo-7-[[(2,4-dimethoxyphenyl)methylamino]methyl]quinolin-8-ol |
| SMILES | COc1ccc(CNCc2cc(Br)c3cccnc3c2O)c(OC)c1 |
| InChI | InChI=1S/C19H19BrN2O3/c1-24-14-6-5-12(17(9-14)25-2)10-21-11-13-8-16(20)15-4-3-7-22-18(15)19(13)23/h3-9,21,23H,10-11H2,1-2H3 |
| InChIKey | WEBNTNGNGVILCF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|