C16H15NO3Se — CID 166635160
2-[(2,4-dimethoxyphenyl)methyl]-1,2-benzoselenazol-3-one (PubChem CID 166635160) has the molecular formula C16H15NO3Se and a molecular weight of 348.26 g/mol. Its IUPAC name is 2-[(2,4-dimethoxyphenyl)methyl]-1,2-benzoselenazol-3-one.
| Compound Name | 2-[(2,4-dimethoxyphenyl)methyl]-1,2-benzoselenazol-3-one |
|---|---|
| PubChem CID | 166635160 |
| Molecular Formula | C16H15NO3Se |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | 2-[(2,4-dimethoxyphenyl)methyl]-1,2-benzoselenazol-3-one |
| SMILES | COc1ccc(Cn2[se]c3ccccc3c2=O)c(OC)c1 |
| InChI | InChI=1S/C16H15NO3Se/c1-19-12-8-7-11(14(9-12)20-2)10-17-16(18)13-5-3-4-6-15(13)21-17/h3-9H,10H2,1-2H3 |
| InChIKey | CSRGTYBEJPCJDH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|