C17H16N2O4 — CID 56771696
3-[(2,4-dimethoxyphenyl)methyl]-1H-quinazoline-2,4-dione (PubChem CID 56771696) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is 3-[(2,4-dimethoxyphenyl)methyl]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[(2,4-dimethoxyphenyl)methyl]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 56771696 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 3-[(2,4-dimethoxyphenyl)methyl]-1H-quinazoline-2,4-dione |
| SMILES | COc1ccc(Cn2c(=O)[nH]c3ccccc3c2=O)c(OC)c1 |
| InChI | InChI=1S/C17H16N2O4/c1-22-12-8-7-11(15(9-12)23-2)10-19-16(20)13-5-3-4-6-14(13)18-17(19)21/h3-9H,10H2,1-2H3,(H,18,21) |
| InChIKey | HROSXLPYIFXCML-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |