C30H27N5O3 — CID 67441940
4-[(4-aminophenyl)methyl]-2-[(2,4-dimethoxyphenyl)methyl]-7-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrolo[1,2-a]pyrazin-1-one (PubChem CID 67441940) has the molecular formula C30H27N5O3 and a molecular weight of 505.58 g/mol. Its IUPAC name is 4-[(4-aminophenyl)methyl]-2-[(2,4-dimethoxyphenyl)methyl]-7-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrolo[1,2-a]pyrazin-1-one.
| Compound Name | 4-[(4-aminophenyl)methyl]-2-[(2,4-dimethoxyphenyl)methyl]-7-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrolo[1,2-a]pyrazin-1-one |
|---|---|
| PubChem CID | 67441940 |
| Molecular Formula | C30H27N5O3 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | 4-[(4-aminophenyl)methyl]-2-[(2,4-dimethoxyphenyl)methyl]-7-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrolo[1,2-a]pyrazin-1-one |
| SMILES | COc1ccc(Cn2cc(Cc3ccc(N)cc3)n3cc(-c4c[nH]c5ncccc45)cc3c2=O)c(OC)c1 |
| InChI | InChI=1S/C30H27N5O3/c1-37-24-10-7-20(28(14-24)38-2)16-34-18-23(12-19-5-8-22(31)9-6-19)35-17-21(13-27(35)30(34)36)26-15-33-29-25(26)4-3-11-32-29/h3-11,13-15,17-18H,12,16,31H2,1-2H3,(H,32,33) |
| InChIKey | YISUGNLBCPYGBP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 99.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|