C18H15N3 — CID 138674165
3-[4-(pyrrol-1-ylmethyl)phenyl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 138674165) has the molecular formula C18H15N3 and a molecular weight of 273.34 g/mol. Its IUPAC name is 3-[4-(pyrrol-1-ylmethyl)phenyl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-[4-(pyrrol-1-ylmethyl)phenyl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 138674165 |
| Molecular Formula | C18H15N3 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 3-[4-(pyrrol-1-ylmethyl)phenyl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | c1cnc2[nH]cc(-c3ccc(Cn4cccc4)cc3)c2c1 |
| InChI | InChI=1S/C18H15N3/c1-2-11-21(10-1)13-14-5-7-15(8-6-14)17-12-20-18-16(17)4-3-9-19-18/h1-12H,13H2,(H,19,20) |
| InChIKey | QKJZTCXOLLCZCH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |