C14H10N4 — CID 123600339
3-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 123600339) has the molecular formula C14H10N4 and a molecular weight of 234.26 g/mol. Its IUPAC name is 3-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 123600339 |
| Molecular Formula | C14H10N4 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 3-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | c1cnc2[nH]cc(-c3cnc4[nH]ccc4c3)c2c1 |
| InChI | InChI=1S/C14H10N4/c1-2-11-12(8-18-14(11)15-4-1)10-6-9-3-5-16-13(9)17-7-10/h1-8H,(H,15,18)(H,16,17) |
| InChIKey | ZTZZOEXKEPRUHO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |