C13H11N3 — CID 170012021
5-methyl-3-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 170012021) has the molecular formula C13H11N3 and a molecular weight of 209.25 g/mol. Its IUPAC name is 5-methyl-3-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-methyl-3-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 170012021 |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 5-methyl-3-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Cc1cnc2[nH]cc(-c3cccnc3)c2c1 |
| InChI | InChI=1S/C13H11N3/c1-9-5-11-12(8-16-13(11)15-6-9)10-3-2-4-14-7-10/h2-8H,1H3,(H,15,16) |
| InChIKey | TWHCYAGNKZFYHE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |