C18H13N3O — CID 59699898
3-(3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenol (PubChem CID 59699898) has the molecular formula C18H13N3O and a molecular weight of 287.32 g/mol. Its IUPAC name is 3-(3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenol.
| Compound Name | 3-(3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenol |
|---|---|
| PubChem CID | 59699898 |
| Molecular Formula | C18H13N3O |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 3-(3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenol |
| SMILES | Oc1cccc(-c2cnc3[nH]cc(-c4ccncc4)c3c2)c1 |
| InChI | InChI=1S/C18H13N3O/c22-15-3-1-2-13(8-15)14-9-16-17(11-21-18(16)20-10-14)12-4-6-19-7-5-12/h1-11,22H,(H,20,21) |
| InChIKey | NRGUQSFDRYOBEH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |