About 4-[5-(3-carbamoylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid
4-[5-(3-carbamoylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid (PubChem CID 11952995) has the molecular formula C21H15N3O3
and a molecular weight of 357.37 g/mol. Its IUPAC name is 4-[5-(3-carbamoylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[5-(3-carbamoylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid |
| PubChem CID | 11952995 |
| Molecular Formula | C21H15N3O3 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 4-[5-(3-carbamoylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid |
| SMILES | NC(=O)c1cccc(-c2cnc3[nH]cc(-c4ccc(C(=O)O)cc4)c3c2)c1 |
| InChI | InChI=1S/C21H15N3O3/c22-19(25)15-3-1-2-14(8-15)16-9-17-18(11-24-20(17)23-10-16)12-4-6-13(7-5-12)21(26)27/h1-11H,(H2,22,25)(H,23,24)(H,26,27) |
| InChIKey | UTHSBONXPZPZRP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 109.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[5-(3-carbamoylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(3-carbamoylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid?
The IUPAC name of 4-[5-(3-carbamoylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid (CID 11952995) is 4-[5-(3-carbamoylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid.
What is the SMILES notation for 4-[5-(3-carbamoylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid?
The canonical SMILES for 4-[5-(3-carbamoylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid is NC(=O)c1cccc(-c2cnc3[nH]cc(-c4ccc(C(=O)O)cc4)c3c2)c1.
What is the InChIKey of 4-[5-(3-carbamoylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid?
The InChIKey is UTHSBONXPZPZRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15N3O3/c22-19(25)15-3-1-2-14(8-15)16-9-17-18(11-24-20(17)23-10-16)12-4-6-13(7-5-12)21(26)27/h1-11H,(H2,22,25)(H,23,24)(H,26,27).
What are the key properties of 4-[5-(3-carbamoylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid?
4-[5-(3-carbamoylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid has a molecular weight of 357.37 g/mol, XLogP of 3.69, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(3-carbamoylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid is sourced from PubChem (CID 11952995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).