C19H20N2O — CID 143178876
3-[3-[(E)-hex-3-en-3-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol (PubChem CID 143178876) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-[3-[(E)-hex-3-en-3-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol.
| Compound Name | 3-[3-[(E)-hex-3-en-3-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol |
|---|---|
| PubChem CID | 143178876 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 3-[3-[(E)-hex-3-en-3-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol |
| SMILES | CC/C=C(\CC)c1c[nH]c2ncc(-c3cccc(O)c3)cc12 |
| InChI | InChI=1S/C19H20N2O/c1-3-6-13(4-2)18-12-21-19-17(18)10-15(11-20-19)14-7-5-8-16(22)9-14/h5-12,22H,3-4H2,1-2H3,(H,20,21)/b13-6+ |
| InChIKey | DEWUGGMAQWJBKJ-AWNIVKPZSA-N |
| XLogP | 5.14 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |