C22H24N2O3 — CID 143178633
ethane;(3Z,5E)-5-[5-(3-hydroxyphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]hepta-3,5-dienoic acid (PubChem CID 143178633) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is ethane;(3Z,5E)-5-[5-(3-hydroxyphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]hepta-3,5-dienoic acid.
| Compound Name | ethane;(3Z,5E)-5-[5-(3-hydroxyphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]hepta-3,5-dienoic acid |
|---|---|
| PubChem CID | 143178633 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | ethane;(3Z,5E)-5-[5-(3-hydroxyphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]hepta-3,5-dienoic acid |
| SMILES | C/C=C(\C=C/CC(=O)O)c1c[nH]c2ncc(-c3cccc(O)c3)cc12.CC |
| InChI | InChI=1S/C20H18N2O3.C2H6/c1-2-13(5-4-8-19(24)25)18-12-22-20-17(18)10-15(11-21-20)14-6-3-7-16(23)9-14;1-2/h2-7,9-12,23H,8H2,1H3,(H,21,22)(H,24,25);1-2H3/b5-4-,13-2+; |
| InChIKey | JDQCXQGEUMPVHW-KXIVTJRNSA-N |
| XLogP | 5.40 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|