C23H14Cl2N2O3 — CID 58087277
(E)-3-[3-[3-(2,4-dichlorobenzoyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enoic acid (PubChem CID 58087277) has the molecular formula C23H14Cl2N2O3 and a molecular weight of 437.28 g/mol. Its IUPAC name is (E)-3-[3-[3-(2,4-dichlorobenzoyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[3-(2,4-dichlorobenzoyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 58087277 |
| Molecular Formula | C23H14Cl2N2O3 |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | (E)-3-[3-[3-(2,4-dichlorobenzoyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(-c2cnc3[nH]cc(C(=O)c4ccc(Cl)cc4Cl)c3c2)c1 |
| InChI | InChI=1S/C23H14Cl2N2O3/c24-16-5-6-17(20(25)10-16)22(30)19-12-27-23-18(19)9-15(11-26-23)14-3-1-2-13(8-14)4-7-21(28)29/h1-12H,(H,26,27)(H,28,29)/b7-4+ |
| InChIKey | AJGICTQHSXYDFE-QPJJXVBHSA-N |
| XLogP | 5.87 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|