C25H21N3O5S — CID 134454192
methyl (Z)-3-[3-[3-[3-(methanesulfonamido)benzoyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enoate (PubChem CID 134454192) has the molecular formula C25H21N3O5S and a molecular weight of 475.53 g/mol. Its IUPAC name is methyl (Z)-3-[3-[3-[3-(methanesulfonamido)benzoyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enoate.
| Compound Name | methyl (Z)-3-[3-[3-[3-(methanesulfonamido)benzoyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 134454192 |
| Molecular Formula | C25H21N3O5S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | methyl (Z)-3-[3-[3-[3-(methanesulfonamido)benzoyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C\c1cccc(-c2cnc3[nH]cc(C(=O)c4cccc(NS(C)(=O)=O)c4)c3c2)c1 |
| InChI | InChI=1S/C25H21N3O5S/c1-33-23(29)10-9-16-5-3-6-17(11-16)19-13-21-22(15-27-25(21)26-14-19)24(30)18-7-4-8-20(12-18)28-34(2,31)32/h3-15,28H,1-2H3,(H,26,27)/b10-9- |
| InChIKey | WSRXFWAOPREROD-KTKRTIGZSA-N |
| XLogP | 4.02 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|