C25H22N3O5S- — CID 158158466
methanesulfinate;methyl (E)-3-[3-[3-(3-aminobenzoyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enoate (PubChem CID 158158466) has the molecular formula C25H22N3O5S- and a molecular weight of 476.53 g/mol. Its IUPAC name is methanesulfinate;methyl (E)-3-[3-[3-(3-aminobenzoyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enoate.
| Compound Name | methanesulfinate;methyl (E)-3-[3-[3-(3-aminobenzoyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 158158466 |
| Molecular Formula | C25H22N3O5S- |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | methanesulfinate;methyl (E)-3-[3-[3-(3-aminobenzoyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cccc(-c2cnc3[nH]cc(C(=O)c4cccc(N)c4)c3c2)c1.CS(=O)[O-] |
| InChI | InChI=1S/C24H19N3O3.CH4O2S/c1-30-22(28)9-8-15-4-2-5-16(10-15)18-12-20-21(14-27-24(20)26-13-18)23(29)17-6-3-7-19(25)11-17;1-4(2)3/h2-14H,25H2,1H3,(H,26,27);1H3,(H,2,3)/p-1/b9-8+; |
| InChIKey | AMRYFOOAGYPPGF-HRNDJLQDSA-M |
| XLogP | 3.72 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|