C24H18N4O2 — CID 122421964
(E)-3-[3-(3-furo[2,3-b]pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]-N-methylprop-2-enamide (PubChem CID 122421964) has the molecular formula C24H18N4O2 and a molecular weight of 394.43 g/mol. Its IUPAC name is (E)-3-[3-(3-furo[2,3-b]pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-[3-(3-furo[2,3-b]pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 122421964 |
| Molecular Formula | C24H18N4O2 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | (E)-3-[3-(3-furo[2,3-b]pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]-N-methylprop-2-enamide |
| SMILES | CNC(=O)/C=C/c1cccc(-c2cnc3[nH]cc(-c4ccnc5occc45)c3c2)c1 |
| InChI | InChI=1S/C24H18N4O2/c1-25-22(29)6-5-15-3-2-4-16(11-15)17-12-20-21(14-28-23(20)27-13-17)18-7-9-26-24-19(18)8-10-30-24/h2-14H,1H3,(H,25,29)(H,27,28)/b6-5+ |
| InChIKey | HMBLCXDWHZVTLX-AATRIKPKSA-N |
| XLogP | 4.80 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|