C23H19N7O — CID 122421290
(E)-2-cyano-N-methyl-3-[3-[3-[6-(methylamino)pyrimidin-4-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enamide (PubChem CID 122421290) has the molecular formula C23H19N7O and a molecular weight of 409.45 g/mol. Its IUPAC name is (E)-2-cyano-N-methyl-3-[3-[3-[6-(methylamino)pyrimidin-4-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-methyl-3-[3-[3-[6-(methylamino)pyrimidin-4-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122421290 |
| Molecular Formula | C23H19N7O |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | (E)-2-cyano-N-methyl-3-[3-[3-[6-(methylamino)pyrimidin-4-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enamide |
| SMILES | CNC(=O)/C(C#N)=C/c1cccc(-c2cnc3[nH]cc(-c4cc(NC)ncn4)c3c2)c1 |
| InChI | InChI=1S/C23H19N7O/c1-25-21-9-20(29-13-30-21)19-12-28-22-18(19)8-17(11-27-22)15-5-3-4-14(6-15)7-16(10-24)23(31)26-2/h3-9,11-13H,1-2H3,(H,26,31)(H,27,28)(H,25,29,30)/b16-7+ |
| InChIKey | AUYVYSWWJIMRPP-FRKPEAEDSA-N |
| XLogP | 3.38 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|