C22H20N6O — CID 122421310
(E)-N-methyl-3-[3-[3-[6-(methylamino)pyrimidin-4-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enamide (PubChem CID 122421310) has the molecular formula C22H20N6O and a molecular weight of 384.44 g/mol. Its IUPAC name is (E)-N-methyl-3-[3-[3-[6-(methylamino)pyrimidin-4-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-methyl-3-[3-[3-[6-(methylamino)pyrimidin-4-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122421310 |
| Molecular Formula | C22H20N6O |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | (E)-N-methyl-3-[3-[3-[6-(methylamino)pyrimidin-4-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enamide |
| SMILES | CNC(=O)/C=C/c1cccc(-c2cnc3[nH]cc(-c4cc(NC)ncn4)c3c2)c1 |
| InChI | InChI=1S/C22H20N6O/c1-23-20-10-19(27-13-28-20)18-12-26-22-17(18)9-16(11-25-22)15-5-3-4-14(8-15)6-7-21(29)24-2/h3-13H,1-2H3,(H,24,29)(H,25,26)(H,23,27,28)/b7-6+ |
| InChIKey | NOJSOMBODOYFEN-VOTSOKGWSA-N |
| XLogP | 3.49 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|